C25H21BrF5N — CID 135002726
1-(2-bromophenyl)-N-[2,6-di(propan-2-yl)phenyl]-1-(2,3,4,5,6-pentafluorophenyl)methanimine (PubChem CID 135002726) has the molecular formula C25H21BrF5N and a molecular weight of 510.34 g/mol. Its IUPAC name is 1-(2-bromophenyl)-N-[2,6-di(propan-2-yl)phenyl]-1-(2,3,4,5,6-pentafluorophenyl)methanimine.
| Compound Name | 1-(2-bromophenyl)-N-[2,6-di(propan-2-yl)phenyl]-1-(2,3,4,5,6-pentafluorophenyl)methanimine |
|---|---|
| PubChem CID | 135002726 |
| Molecular Formula | C25H21BrF5N |
| Molecular Weight | 510.34 g/mol |
| Exact Mass | 509.08 |
| IUPAC Name | 1-(2-bromophenyl)-N-[2,6-di(propan-2-yl)phenyl]-1-(2,3,4,5,6-pentafluorophenyl)methanimine |
| SMILES | CC(C)c1cccc(C(C)C)c1/N=C(\c1ccccc1Br)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C25H21BrF5N/c1-12(2)14-9-7-10-15(13(3)4)24(14)32-25(16-8-5-6-11-17(16)26)18-19(27)21(29)23(31)22(30)20(18)28/h5-13H,1-4H3/b32-25+ |
| InChIKey | DJELUGQKGQUWAS-WGPBWIAQSA-N |
| XLogP | 8.56 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.34 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|