C16H24O6 — CID 135002729
diethyl 6-oxo-4-pentyl-2H-pyran-3,3-dicarboxylate (PubChem CID 135002729) has the molecular formula C16H24O6 and a molecular weight of 312.36 g/mol. Its IUPAC name is diethyl 6-oxo-4-pentyl-2H-pyran-3,3-dicarboxylate.
| Compound Name | diethyl 6-oxo-4-pentyl-2H-pyran-3,3-dicarboxylate |
|---|---|
| PubChem CID | 135002729 |
| Molecular Formula | C16H24O6 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | diethyl 6-oxo-4-pentyl-2H-pyran-3,3-dicarboxylate |
| SMILES | CCCCCC1=CC(=O)OCC1(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C16H24O6/c1-4-7-8-9-12-10-13(17)22-11-16(12,14(18)20-5-2)15(19)21-6-3/h10H,4-9,11H2,1-3H3 |
| InChIKey | YEALKRGJCQIEQP-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|