C31H30F6N2O2 — CID 135002868
methyl (2R)-3-[bis(prop-2-enyl)amino]-2-[bis[4-(trifluoromethyl)phenyl]methylamino]-3-phenylpropanoate (PubChem CID 135002868) has the molecular formula C31H30F6N2O2 and a molecular weight of 576.58 g/mol. Its IUPAC name is methyl (2R)-3-[bis(prop-2-enyl)amino]-2-[bis[4-(trifluoromethyl)phenyl]methylamino]-3-phenylpropanoate.
| Compound Name | methyl (2R)-3-[bis(prop-2-enyl)amino]-2-[bis[4-(trifluoromethyl)phenyl]methylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 135002868 |
| Molecular Formula | C31H30F6N2O2 |
| Molecular Weight | 576.58 g/mol |
| Exact Mass | 576.22 |
| IUPAC Name | methyl (2R)-3-[bis(prop-2-enyl)amino]-2-[bis[4-(trifluoromethyl)phenyl]methylamino]-3-phenylpropanoate |
| SMILES | C=CCN(CC=C)C(c1ccccc1)[C@@H](NC(c1ccc(C(F)(F)F)cc1)c1ccc(C(F)(F)F)cc1)C(=O)OC |
| InChI | InChI=1S/C31H30F6N2O2/c1-4-19-39(20-5-2)28(23-9-7-6-8-10-23)27(29(40)41-3)38-26(21-11-15-24(16-12-21)30(32,33)34)22-13-17-25(18-14-22)31(35,36)37/h4-18,26-28,38H,1-2,19-20H2,3H3/t27-,28?/m1/s1 |
| InChIKey | XGQKMHRSIRNPRN-QXPUDEPPSA-N |
| XLogP | 7.36 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.58 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|