C32H31NO4 — CID 135002953
(1S,8S)-1-[(E)-2-methoxyhept-2-en-3-yl]-8,11-diphenyl-14-oxa-11-azatetracyclo[6.5.1.02,7.09,13]tetradeca-2,4,6-triene-10,12-dione (PubChem CID 135002953) has the molecular formula C32H31NO4 and a molecular weight of 493.60 g/mol. Its IUPAC name is (1S,8S)-1-[(E)-2-methoxyhept-2-en-3-yl]-8,11-diphenyl-14-oxa-11-azatetracyclo[6.5.1.02,7.09,13]tetradeca-2,4,6-triene-10,12-dione.
| Compound Name | (1S,8S)-1-[(E)-2-methoxyhept-2-en-3-yl]-8,11-diphenyl-14-oxa-11-azatetracyclo[6.5.1.02,7.09,13]tetradeca-2,4,6-triene-10,12-dione |
|---|---|
| PubChem CID | 135002953 |
| Molecular Formula | C32H31NO4 |
| Molecular Weight | 493.60 g/mol |
| Exact Mass | 493.23 |
| IUPAC Name | (1S,8S)-1-[(E)-2-methoxyhept-2-en-3-yl]-8,11-diphenyl-14-oxa-11-azatetracyclo[6.5.1.02,7.09,13]tetradeca-2,4,6-triene-10,12-dione |
| SMILES | CCCC/C(=C(/C)OC)[C@@]12O[C@@](c3ccccc3)(c3ccccc31)C1C(=O)N(c3ccccc3)C(=O)C12 |
| InChI | InChI=1S/C32H31NO4/c1-4-5-18-24(21(2)36-3)32-26-20-13-12-19-25(26)31(37-32,22-14-8-6-9-15-22)27-28(32)30(35)33(29(27)34)23-16-10-7-11-17-23/h6-17,19-20,27-28H,4-5,18H2,1-3H3/b24-21+/t27?,28?,31-,32+/m0/s1 |
| InChIKey | NLIJUDOVJWKREI-YMJOVDOGSA-N |
| XLogP | 6.09 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.60 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|