C21H26F3NO2 — CID 135003172
(2S,4S)-2-hydroxy-4-octyl-6-phenyl-2-(trifluoromethyl)-3,4-dihydropyran-5-carbonitrile (PubChem CID 135003172) has the molecular formula C21H26F3NO2 and a molecular weight of 381.44 g/mol. Its IUPAC name is (2S,4S)-2-hydroxy-4-octyl-6-phenyl-2-(trifluoromethyl)-3,4-dihydropyran-5-carbonitrile.
| Compound Name | (2S,4S)-2-hydroxy-4-octyl-6-phenyl-2-(trifluoromethyl)-3,4-dihydropyran-5-carbonitrile |
|---|---|
| PubChem CID | 135003172 |
| Molecular Formula | C21H26F3NO2 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | (2S,4S)-2-hydroxy-4-octyl-6-phenyl-2-(trifluoromethyl)-3,4-dihydropyran-5-carbonitrile |
| SMILES | CCCCCCCC[C@H]1C[C@@](O)(C(F)(F)F)OC(c2ccccc2)=C1C#N |
| InChI | InChI=1S/C21H26F3NO2/c1-2-3-4-5-6-8-13-17-14-20(26,21(22,23)24)27-19(18(17)15-25)16-11-9-7-10-12-16/h7,9-12,17,26H,2-6,8,13-14H2,1H3/t17-,20-/m0/s1 |
| InChIKey | QIIKJLYGTZWPBM-PXNSSMCTSA-N |
| XLogP | 5.96 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|