C24H36N2O4 — CID 135003227
tert-butyl (2S)-2-[[(2S)-2-[(4R)-2,2-dimethyl-4-phenyl-1,3-oxazolidin-3-yl]hex-5-enoyl]amino]propanoate (PubChem CID 135003227) has the molecular formula C24H36N2O4 and a molecular weight of 416.56 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[(2S)-2-[(4R)-2,2-dimethyl-4-phenyl-1,3-oxazolidin-3-yl]hex-5-enoyl]amino]propanoate.
| Compound Name | tert-butyl (2S)-2-[[(2S)-2-[(4R)-2,2-dimethyl-4-phenyl-1,3-oxazolidin-3-yl]hex-5-enoyl]amino]propanoate |
|---|---|
| PubChem CID | 135003227 |
| Molecular Formula | C24H36N2O4 |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.27 |
| IUPAC Name | tert-butyl (2S)-2-[[(2S)-2-[(4R)-2,2-dimethyl-4-phenyl-1,3-oxazolidin-3-yl]hex-5-enoyl]amino]propanoate |
| SMILES | C=CCC[C@@H](C(=O)N[C@@H](C)C(=O)OC(C)(C)C)N1[C@H](c2ccccc2)COC1(C)C |
| InChI | InChI=1S/C24H36N2O4/c1-8-9-15-19(21(27)25-17(2)22(28)30-23(3,4)5)26-20(16-29-24(26,6)7)18-13-11-10-12-14-18/h8,10-14,17,19-20H,1,9,15-16H2,2-7H3,(H,25,27)/t17-,19-,20-/m0/s1 |
| InChIKey | RKKVGPHEVHBOMC-IHPCNDPISA-N |
| XLogP | 3.98 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|