C20H25N3O4 — CID 135003523
ethyl (4aS,5R,10bS)-9-acetamido-3-acetyl-1-methyl-4a,5,6,10b-tetrahydro-4H-benzo[h][1,6]naphthyridine-5-carboxylate (PubChem CID 135003523) has the molecular formula C20H25N3O4 and a molecular weight of 371.44 g/mol. Its IUPAC name is ethyl (4aS,5R,10bS)-9-acetamido-3-acetyl-1-methyl-4a,5,6,10b-tetrahydro-4H-benzo[h][1,6]naphthyridine-5-carboxylate.
| Compound Name | ethyl (4aS,5R,10bS)-9-acetamido-3-acetyl-1-methyl-4a,5,6,10b-tetrahydro-4H-benzo[h][1,6]naphthyridine-5-carboxylate |
|---|---|
| PubChem CID | 135003523 |
| Molecular Formula | C20H25N3O4 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | ethyl (4aS,5R,10bS)-9-acetamido-3-acetyl-1-methyl-4a,5,6,10b-tetrahydro-4H-benzo[h][1,6]naphthyridine-5-carboxylate |
| SMILES | CCOC(=O)[C@@H]1Nc2ccc(NC(C)=O)cc2[C@@H]2[C@H]1CC(C(C)=O)=CN2C |
| InChI | InChI=1S/C20H25N3O4/c1-5-27-20(26)18-16-8-13(11(2)24)10-23(4)19(16)15-9-14(21-12(3)25)6-7-17(15)22-18/h6-7,9-10,16,18-19,22H,5,8H2,1-4H3,(H,21,25)/t16-,18+,19+/m0/s1 |
| InChIKey | HMTOAGROEARMMX-QXAKKESOSA-N |
| XLogP | 2.47 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |