About 1-[butoxy-[(E)-1,2-dichloroethenyl]phosphoryl]oxybutane
1-[butoxy-[(E)-1,2-dichloroethenyl]phosphoryl]oxybutane (PubChem CID 135003535) has the molecular formula C10H19Cl2O3P
and a molecular weight of 289.14 g/mol. Its IUPAC name is 1-[butoxy-[(E)-1,2-dichloroethenyl]phosphoryl]oxybutane.
Molecular Properties
| Compound Name | 1-[butoxy-[(E)-1,2-dichloroethenyl]phosphoryl]oxybutane |
| PubChem CID | 135003535 |
| Molecular Formula | C10H19Cl2O3P |
| Molecular Weight | 289.14 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | 1-[butoxy-[(E)-1,2-dichloroethenyl]phosphoryl]oxybutane |
| SMILES | CCCCOP(=O)(OCCCC)/C(Cl)=C\Cl |
| InChI | InChI=1S/C10H19Cl2O3P/c1-3-5-7-14-16(13,10(12)9-11)15-8-6-4-2/h9H,3-8H2,1-2H3/b10-9- |
| InChIKey | AMRNANFNKILRLI-KTKRTIGZSA-N |
| XLogP | 5.09 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 289.14 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-[butoxy-[(E)-1,2-dichloroethenyl]phosphoryl]oxybutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[butoxy-[(E)-1,2-dichloroethenyl]phosphoryl]oxybutane?
The IUPAC name of 1-[butoxy-[(E)-1,2-dichloroethenyl]phosphoryl]oxybutane (CID 135003535) is 1-[butoxy-[(E)-1,2-dichloroethenyl]phosphoryl]oxybutane.
What is the SMILES notation for 1-[butoxy-[(E)-1,2-dichloroethenyl]phosphoryl]oxybutane?
The canonical SMILES for 1-[butoxy-[(E)-1,2-dichloroethenyl]phosphoryl]oxybutane is CCCCOP(=O)(OCCCC)/C(Cl)=C\Cl.
What is the InChIKey of 1-[butoxy-[(E)-1,2-dichloroethenyl]phosphoryl]oxybutane?
The InChIKey is AMRNANFNKILRLI-KTKRTIGZSA-N. The full InChI is InChI=1S/C10H19Cl2O3P/c1-3-5-7-14-16(13,10(12)9-11)15-8-6-4-2/h9H,3-8H2,1-2H3/b10-9-.
What are the key properties of 1-[butoxy-[(E)-1,2-dichloroethenyl]phosphoryl]oxybutane?
1-[butoxy-[(E)-1,2-dichloroethenyl]phosphoryl]oxybutane has a molecular weight of 289.14 g/mol, XLogP of 5.09, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[butoxy-[(E)-1,2-dichloroethenyl]phosphoryl]oxybutane is sourced from PubChem (CID 135003535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).