C10H19Cl2O3P — CID 135003535
1-[butoxy-[(E)-1,2-dichloroethenyl]phosphoryl]oxybutane (PubChem CID 135003535) has the molecular formula C10H19Cl2O3P and a molecular weight of 289.14 g/mol. Its IUPAC name is 1-[butoxy-[(E)-1,2-dichloroethenyl]phosphoryl]oxybutane.
| Compound Name | 1-[butoxy-[(E)-1,2-dichloroethenyl]phosphoryl]oxybutane |
|---|---|
| PubChem CID | 135003535 |
| Molecular Formula | C10H19Cl2O3P |
| Molecular Weight | 289.14 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | 1-[butoxy-[(E)-1,2-dichloroethenyl]phosphoryl]oxybutane |
| SMILES | CCCCOP(=O)(OCCCC)/C(Cl)=C\Cl |
| InChI | InChI=1S/C10H19Cl2O3P/c1-3-5-7-14-16(13,10(12)9-11)15-8-6-4-2/h9H,3-8H2,1-2H3/b10-9- |
| InChIKey | AMRNANFNKILRLI-KTKRTIGZSA-N |
| XLogP | 5.09 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.14 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|