C16H15NO6 — CID 135003562
dimethyl 1-benzyl-4-hydroxy-6-oxopyridine-2,3-dicarboxylate (PubChem CID 135003562) has the molecular formula C16H15NO6 and a molecular weight of 317.30 g/mol. Its IUPAC name is dimethyl 1-benzyl-4-hydroxy-6-oxopyridine-2,3-dicarboxylate.
| Compound Name | dimethyl 1-benzyl-4-hydroxy-6-oxopyridine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 135003562 |
| Molecular Formula | C16H15NO6 |
| Molecular Weight | 317.30 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | dimethyl 1-benzyl-4-hydroxy-6-oxopyridine-2,3-dicarboxylate |
| SMILES | COC(=O)c1c(O)cc(=O)n(Cc2ccccc2)c1C(=O)OC |
| InChI | InChI=1S/C16H15NO6/c1-22-15(20)13-11(18)8-12(19)17(14(13)16(21)23-2)9-10-6-4-3-5-7-10/h3-8,18H,9H2,1-2H3 |
| InChIKey | QFHHMNUSXOPTKY-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.30 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |