C14H16N2O3 — CID 135003571
N-[(3aS,4R,7S,7aS)-2,7-dimethyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-4-yl]but-2-ynamide (PubChem CID 135003571) has the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. Its IUPAC name is N-[(3aS,4R,7S,7aS)-2,7-dimethyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-4-yl]but-2-ynamide.
| Compound Name | N-[(3aS,4R,7S,7aS)-2,7-dimethyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-4-yl]but-2-ynamide |
|---|---|
| PubChem CID | 135003571 |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | N-[(3aS,4R,7S,7aS)-2,7-dimethyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-4-yl]but-2-ynamide |
| SMILES | CC#CC(=O)N[C@@H]1C=C[C@H](C)[C@@H]2C(=O)N(C)C(=O)[C@@H]21 |
| InChI | InChI=1S/C14H16N2O3/c1-4-5-10(17)15-9-7-6-8(2)11-12(9)14(19)16(3)13(11)18/h6-9,11-12H,1-3H3,(H,15,17)/t8-,9+,11-,12+/m0/s1 |
| InChIKey | CGIZWEFMVXUOCO-BSJXLVFVSA-N |
| XLogP | -0.07 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|