C13H14N2O — CID 135003881
(8aR)-4-methyl-5-oxo-2,3,6,7,8,8a-hexahydronaphthalene-1,1-dicarbonitrile (PubChem CID 135003881) has the molecular formula C13H14N2O and a molecular weight of 214.27 g/mol. Its IUPAC name is (8aR)-4-methyl-5-oxo-2,3,6,7,8,8a-hexahydronaphthalene-1,1-dicarbonitrile.
| Compound Name | (8aR)-4-methyl-5-oxo-2,3,6,7,8,8a-hexahydronaphthalene-1,1-dicarbonitrile |
|---|---|
| PubChem CID | 135003881 |
| Molecular Formula | C13H14N2O |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | (8aR)-4-methyl-5-oxo-2,3,6,7,8,8a-hexahydronaphthalene-1,1-dicarbonitrile |
| SMILES | CC1=C2C(=O)CCC[C@@H]2C(C#N)(C#N)CC1 |
| InChI | InChI=1S/C13H14N2O/c1-9-5-6-13(7-14,8-15)10-3-2-4-11(16)12(9)10/h10H,2-6H2,1H3/t10-/m0/s1 |
| InChIKey | UEONPFKQYHJXCO-JTQLQIEISA-N |
| XLogP | 2.50 |
| TPSA | 64.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |