C26H38N2O5 — CID 135004025
diethyl (Z)-2-(cyclohexylcarbamoyl)-3-[diethylamino(phenyl)methyl]but-2-enedioate (PubChem CID 135004025) has the molecular formula C26H38N2O5 and a molecular weight of 458.60 g/mol. Its IUPAC name is diethyl (Z)-2-(cyclohexylcarbamoyl)-3-[diethylamino(phenyl)methyl]but-2-enedioate.
| Compound Name | diethyl (Z)-2-(cyclohexylcarbamoyl)-3-[diethylamino(phenyl)methyl]but-2-enedioate |
|---|---|
| PubChem CID | 135004025 |
| Molecular Formula | C26H38N2O5 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.28 |
| IUPAC Name | diethyl (Z)-2-(cyclohexylcarbamoyl)-3-[diethylamino(phenyl)methyl]but-2-enedioate |
| SMILES | CCOC(=O)/C(C(=O)NC1CCCCC1)=C(\C(=O)OCC)C(c1ccccc1)N(CC)CC |
| InChI | InChI=1S/C26H38N2O5/c1-5-28(6-2)23(19-15-11-9-12-16-19)21(25(30)32-7-3)22(26(31)33-8-4)24(29)27-20-17-13-10-14-18-20/h9,11-12,15-16,20,23H,5-8,10,13-14,17-18H2,1-4H3,(H,27,29)/b22-21- |
| InChIKey | CRIXNCRLKRQXTE-DQRAZIAOSA-N |
| XLogP | 3.94 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|