About [(1-benzyl-5-phenyltriazol-4-yl)-ethoxymethylidene]tungsten;carbon monoxide
[(1-benzyl-5-phenyltriazol-4-yl)-ethoxymethylidene]tungsten;carbon monoxide (PubChem CID 135004178) has the molecular formula C23H17N3O6W
and a molecular weight of 615.24 g/mol. Its IUPAC name is [(1-benzyl-5-phenyltriazol-4-yl)-ethoxymethylidene]tungsten;carbon monoxide.
Molecular Properties
| Compound Name | [(1-benzyl-5-phenyltriazol-4-yl)-ethoxymethylidene]tungsten;carbon monoxide |
| PubChem CID | 135004178 |
| Molecular Formula | C23H17N3O6W |
| Molecular Weight | 615.24 g/mol |
| Exact Mass | 615.06 |
| IUPAC Name | [(1-benzyl-5-phenyltriazol-4-yl)-ethoxymethylidene]tungsten;carbon monoxide |
| SMILES | CCOC(=[W])c1nnn(Cc2ccccc2)c1-c1ccccc1.[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+] |
| InChI | InChI=1S/C18H17N3O.5CO.W/c1-2-22-14-17-18(16-11-7-4-8-12-16)21(20-19-17)13-15-9-5-3-6-10-15;5*1-2;/h3-12H,2,13H2,1H3;;;;;; |
| InChIKey | OHUBKDAVXJGHSH-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 139.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 615.24 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze [(1-benzyl-5-phenyltriazol-4-yl)-ethoxymethylidene]tungsten;carbon monoxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1-benzyl-5-phenyltriazol-4-yl)-ethoxymethylidene]tungsten;carbon monoxide?
The IUPAC name of [(1-benzyl-5-phenyltriazol-4-yl)-ethoxymethylidene]tungsten;carbon monoxide (CID 135004178) is [(1-benzyl-5-phenyltriazol-4-yl)-ethoxymethylidene]tungsten;carbon monoxide.
What is the SMILES notation for [(1-benzyl-5-phenyltriazol-4-yl)-ethoxymethylidene]tungsten;carbon monoxide?
The canonical SMILES for [(1-benzyl-5-phenyltriazol-4-yl)-ethoxymethylidene]tungsten;carbon monoxide is CCOC(=[W])c1nnn(Cc2ccccc2)c1-c1ccccc1.[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].
What is the InChIKey of [(1-benzyl-5-phenyltriazol-4-yl)-ethoxymethylidene]tungsten;carbon monoxide?
The InChIKey is OHUBKDAVXJGHSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17N3O.5CO.W/c1-2-22-14-17-18(16-11-7-4-8-12-16)21(20-19-17)13-15-9-5-3-6-10-15;5*1-2;/h3-12H,2,13H2,1H3;;;;;;.
What are the key properties of [(1-benzyl-5-phenyltriazol-4-yl)-ethoxymethylidene]tungsten;carbon monoxide?
[(1-benzyl-5-phenyltriazol-4-yl)-ethoxymethylidene]tungsten;carbon monoxide has a molecular weight of 615.24 g/mol, XLogP of 2.87, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1-benzyl-5-phenyltriazol-4-yl)-ethoxymethylidene]tungsten;carbon monoxide is sourced from PubChem (CID 135004178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).