C14H20O2Si — CID 135004381
(1S,6S,7R)-7-trimethylsilyloxybicyclo[4.4.1]undeca-2,4,8-trien-11-one (PubChem CID 135004381) has the molecular formula C14H20O2Si and a molecular weight of 248.40 g/mol. Its IUPAC name is (1S,6S,7R)-7-trimethylsilyloxybicyclo[4.4.1]undeca-2,4,8-trien-11-one.
| Compound Name | (1S,6S,7R)-7-trimethylsilyloxybicyclo[4.4.1]undeca-2,4,8-trien-11-one |
|---|---|
| PubChem CID | 135004381 |
| Molecular Formula | C14H20O2Si |
| Molecular Weight | 248.40 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | (1S,6S,7R)-7-trimethylsilyloxybicyclo[4.4.1]undeca-2,4,8-trien-11-one |
| SMILES | C[Si](C)(C)O[C@@H]1C=CC[C@H]2C=CC=C[C@@H]1C2=O |
| InChI | InChI=1S/C14H20O2Si/c1-17(2,3)16-13-10-6-8-11-7-4-5-9-12(13)14(11)15/h4-7,9-13H,8H2,1-3H3/t11-,12+,13-/m1/s1 |
| InChIKey | OCLOGJAPQHKNAR-FRRDWIJNSA-N |
| XLogP | 3.09 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.40 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|