C20H30O2Si — CID 135004382
(1R,5S,9R)-7-[tert-butyl(dimethyl)silyl]oxytricyclo[7.4.1.01,5]tetradeca-6,10,12-trien-14-one (PubChem CID 135004382) has the molecular formula C20H30O2Si and a molecular weight of 330.54 g/mol. Its IUPAC name is (1R,5S,9R)-7-[tert-butyl(dimethyl)silyl]oxytricyclo[7.4.1.01,5]tetradeca-6,10,12-trien-14-one.
| Compound Name | (1R,5S,9R)-7-[tert-butyl(dimethyl)silyl]oxytricyclo[7.4.1.01,5]tetradeca-6,10,12-trien-14-one |
|---|---|
| PubChem CID | 135004382 |
| Molecular Formula | C20H30O2Si |
| Molecular Weight | 330.54 g/mol |
| Exact Mass | 330.20 |
| IUPAC Name | (1R,5S,9R)-7-[tert-butyl(dimethyl)silyl]oxytricyclo[7.4.1.01,5]tetradeca-6,10,12-trien-14-one |
| SMILES | CC(C)(C)[Si](C)(C)OC1=C[C@@H]2CCC[C@@]23C=CC=C[C@@H](C1)C3=O |
| InChI | InChI=1S/C20H30O2Si/c1-19(2,3)23(4,5)22-17-13-15-9-6-7-11-20(18(15)21)12-8-10-16(20)14-17/h6-7,9,11,14-16H,8,10,12-13H2,1-5H3/t15-,16-,20-/m0/s1 |
| InChIKey | KZZZFTIFNRNPNA-FTRWYGJKSA-N |
| XLogP | 5.39 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.54 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|