About ethyl (3S)-2,2-difluoro-3-[[(1R)-2-methoxy-1-phenylethyl]amino]-4-methylpentanoate
ethyl (3S)-2,2-difluoro-3-[[(1R)-2-methoxy-1-phenylethyl]amino]-4-methylpentanoate (PubChem CID 135004398) has the molecular formula C17H25F2NO3
and a molecular weight of 329.39 g/mol. Its IUPAC name is ethyl (3S)-2,2-difluoro-3-[[(1R)-2-methoxy-1-phenylethyl]amino]-4-methylpentanoate.
Molecular Properties
| Compound Name | ethyl (3S)-2,2-difluoro-3-[[(1R)-2-methoxy-1-phenylethyl]amino]-4-methylpentanoate |
| PubChem CID | 135004398 |
| Molecular Formula | C17H25F2NO3 |
| Molecular Weight | 329.39 g/mol |
| Exact Mass | 329.18 |
| IUPAC Name | ethyl (3S)-2,2-difluoro-3-[[(1R)-2-methoxy-1-phenylethyl]amino]-4-methylpentanoate |
| SMILES | CCOC(=O)C(F)(F)[C@@H](N[C@@H](COC)c1ccccc1)C(C)C |
| InChI | InChI=1S/C17H25F2NO3/c1-5-23-16(21)17(18,19)15(12(2)3)20-14(11-22-4)13-9-7-6-8-10-13/h6-10,12,14-15,20H,5,11H2,1-4H3/t14-,15-/m0/s1 |
| InChIKey | JBFWTRPHGJDNFB-GJZGRUSLSA-N |
| XLogP | 3.19 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.39 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl (3S)-2,2-difluoro-3-[[(1R)-2-methoxy-1-phenylethyl]amino]-4-methylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (3S)-2,2-difluoro-3-[[(1R)-2-methoxy-1-phenylethyl]amino]-4-methylpentanoate?
The IUPAC name of ethyl (3S)-2,2-difluoro-3-[[(1R)-2-methoxy-1-phenylethyl]amino]-4-methylpentanoate (CID 135004398) is ethyl (3S)-2,2-difluoro-3-[[(1R)-2-methoxy-1-phenylethyl]amino]-4-methylpentanoate.
What is the SMILES notation for ethyl (3S)-2,2-difluoro-3-[[(1R)-2-methoxy-1-phenylethyl]amino]-4-methylpentanoate?
The canonical SMILES for ethyl (3S)-2,2-difluoro-3-[[(1R)-2-methoxy-1-phenylethyl]amino]-4-methylpentanoate is CCOC(=O)C(F)(F)[C@@H](N[C@@H](COC)c1ccccc1)C(C)C.
What is the InChIKey of ethyl (3S)-2,2-difluoro-3-[[(1R)-2-methoxy-1-phenylethyl]amino]-4-methylpentanoate?
The InChIKey is JBFWTRPHGJDNFB-GJZGRUSLSA-N. The full InChI is InChI=1S/C17H25F2NO3/c1-5-23-16(21)17(18,19)15(12(2)3)20-14(11-22-4)13-9-7-6-8-10-13/h6-10,12,14-15,20H,5,11H2,1-4H3/t14-,15-/m0/s1.
What are the key properties of ethyl (3S)-2,2-difluoro-3-[[(1R)-2-methoxy-1-phenylethyl]amino]-4-methylpentanoate?
ethyl (3S)-2,2-difluoro-3-[[(1R)-2-methoxy-1-phenylethyl]amino]-4-methylpentanoate has a molecular weight of 329.39 g/mol, XLogP of 3.19, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (3S)-2,2-difluoro-3-[[(1R)-2-methoxy-1-phenylethyl]amino]-4-methylpentanoate is sourced from PubChem (CID 135004398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).