C25H29FO2Si — CID 135004524
(1R,2R)-3-[tert-butyl(diphenyl)silyl]oxy-1-fluoro-1-phenylpropan-2-ol (PubChem CID 135004524) has the molecular formula C25H29FO2Si and a molecular weight of 408.59 g/mol. Its IUPAC name is (1R,2R)-3-[tert-butyl(diphenyl)silyl]oxy-1-fluoro-1-phenylpropan-2-ol.
| Compound Name | (1R,2R)-3-[tert-butyl(diphenyl)silyl]oxy-1-fluoro-1-phenylpropan-2-ol |
|---|---|
| PubChem CID | 135004524 |
| Molecular Formula | C25H29FO2Si |
| Molecular Weight | 408.59 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | (1R,2R)-3-[tert-butyl(diphenyl)silyl]oxy-1-fluoro-1-phenylpropan-2-ol |
| SMILES | CC(C)(C)[Si](OC[C@@H](O)[C@H](F)c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H29FO2Si/c1-25(2,3)29(21-15-9-5-10-16-21,22-17-11-6-12-18-22)28-19-23(27)24(26)20-13-7-4-8-14-20/h4-18,23-24,27H,19H2,1-3H3/t23-,24-/m1/s1 |
| InChIKey | LJGLXNOUTGOHMI-DNQXCXABSA-N |
| XLogP | 4.63 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.59 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|