C27H38CrN2O2Si — CID 135004560
[[(4S,5S)-4-(furan-2-yl)-5-trimethylsilyl-4,5-dihydro-1H-pyrazol-3-yl]-[(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl]oxymethylidene]chromium (PubChem CID 135004560) has the molecular formula C27H38CrN2O2Si and a molecular weight of 502.70 g/mol. Its IUPAC name is [[(4S,5S)-4-(furan-2-yl)-5-trimethylsilyl-4,5-dihydro-1H-pyrazol-3-yl]-[(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl]oxymethylidene]chromium.
| Compound Name | [[(4S,5S)-4-(furan-2-yl)-5-trimethylsilyl-4,5-dihydro-1H-pyrazol-3-yl]-[(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl]oxymethylidene]chromium |
|---|---|
| PubChem CID | 135004560 |
| Molecular Formula | C27H38CrN2O2Si |
| Molecular Weight | 502.70 g/mol |
| Exact Mass | 502.21 |
| IUPAC Name | [[(4S,5S)-4-(furan-2-yl)-5-trimethylsilyl-4,5-dihydro-1H-pyrazol-3-yl]-[(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl]oxymethylidene]chromium |
| SMILES | C[C@@H]1CC[C@@H](C(C)(C)c2ccccc2)[C@H](OC(=[Cr])C2=NN[C@@H]([Si](C)(C)C)[C@@H]2c2ccco2)C1 |
| InChI | InChI=1S/C27H38N2O2Si.Cr/c1-19-14-15-21(27(2,3)20-11-8-7-9-12-20)24(17-19)31-18-22-25(23-13-10-16-30-23)26(29-28-22)32(4,5)6;/h7-13,16,19,21,24-26,29H,14-15,17H2,1-6H3;/t19-,21-,24-,25+,26+;/m1./s1 |
| InChIKey | QMINAADWRVQBIA-NYCSZVISSA-N |
| XLogP | 6.04 |
| TPSA | 46.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.70 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|