C31H27NO6 — CID 135004623
dibenzyl 2-[(1S)-3-(1-oxidopyridin-1-ium-2-yl)-3-oxo-1-phenylpropyl]propanedioate (PubChem CID 135004623) has the molecular formula C31H27NO6 and a molecular weight of 509.56 g/mol. Its IUPAC name is dibenzyl 2-[(1S)-3-(1-oxidopyridin-1-ium-2-yl)-3-oxo-1-phenylpropyl]propanedioate.
| Compound Name | dibenzyl 2-[(1S)-3-(1-oxidopyridin-1-ium-2-yl)-3-oxo-1-phenylpropyl]propanedioate |
|---|---|
| PubChem CID | 135004623 |
| Molecular Formula | C31H27NO6 |
| Molecular Weight | 509.56 g/mol |
| Exact Mass | 509.18 |
| IUPAC Name | dibenzyl 2-[(1S)-3-(1-oxidopyridin-1-ium-2-yl)-3-oxo-1-phenylpropyl]propanedioate |
| SMILES | O=C(C[C@H](c1ccccc1)C(C(=O)OCc1ccccc1)C(=O)OCc1ccccc1)c1cccc[n+]1[O-] |
| InChI | InChI=1S/C31H27NO6/c33-28(27-18-10-11-19-32(27)36)20-26(25-16-8-3-9-17-25)29(30(34)37-21-23-12-4-1-5-13-23)31(35)38-22-24-14-6-2-7-15-24/h1-19,26,29H,20-22H2/t26-/m1/s1 |
| InChIKey | XNGLDWNUGWZJKB-AREMUKBSSA-N |
| XLogP | 4.78 |
| TPSA | 96.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.56 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|