C21H21NO5 — CID 135004645
methyl 3-[(3S,4R)-3-benzyl-3-hydroxy-2,5-dioxo-4-phenylpyrrolidin-1-yl]propanoate (PubChem CID 135004645) has the molecular formula C21H21NO5 and a molecular weight of 367.40 g/mol. Its IUPAC name is methyl 3-[(3S,4R)-3-benzyl-3-hydroxy-2,5-dioxo-4-phenylpyrrolidin-1-yl]propanoate.
| Compound Name | methyl 3-[(3S,4R)-3-benzyl-3-hydroxy-2,5-dioxo-4-phenylpyrrolidin-1-yl]propanoate |
|---|---|
| PubChem CID | 135004645 |
| Molecular Formula | C21H21NO5 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | methyl 3-[(3S,4R)-3-benzyl-3-hydroxy-2,5-dioxo-4-phenylpyrrolidin-1-yl]propanoate |
| SMILES | COC(=O)CCN1C(=O)[C@H](c2ccccc2)[C@@](O)(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C21H21NO5/c1-27-17(23)12-13-22-19(24)18(16-10-6-3-7-11-16)21(26,20(22)25)14-15-8-4-2-5-9-15/h2-11,18,26H,12-14H2,1H3/t18-,21-/m0/s1 |
| InChIKey | WRAJPJJGMADSIW-RXVVDRJESA-N |
| XLogP | 1.68 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|