About trimethyl 1-cyclohexyl-2-methyl-6-oxopyridine-3,4,5-tricarboxylate
trimethyl 1-cyclohexyl-2-methyl-6-oxopyridine-3,4,5-tricarboxylate (PubChem CID 135005013) has the molecular formula C18H23NO7
and a molecular weight of 365.38 g/mol. Its IUPAC name is trimethyl 1-cyclohexyl-2-methyl-6-oxopyridine-3,4,5-tricarboxylate.
Molecular Properties
| Compound Name | trimethyl 1-cyclohexyl-2-methyl-6-oxopyridine-3,4,5-tricarboxylate |
| PubChem CID | 135005013 |
| Molecular Formula | C18H23NO7 |
| Molecular Weight | 365.38 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | trimethyl 1-cyclohexyl-2-methyl-6-oxopyridine-3,4,5-tricarboxylate |
| SMILES | COC(=O)c1c(C(=O)OC)c(C)n(C2CCCCC2)c(=O)c1C(=O)OC |
| InChI | InChI=1S/C18H23NO7/c1-10-12(16(21)24-2)13(17(22)25-3)14(18(23)26-4)15(20)19(10)11-8-6-5-7-9-11/h11H,5-9H2,1-4H3 |
| InChIKey | IXYMPSLDPQWWOF-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 100.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.38 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze trimethyl 1-cyclohexyl-2-methyl-6-oxopyridine-3,4,5-tricarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl 1-cyclohexyl-2-methyl-6-oxopyridine-3,4,5-tricarboxylate?
The IUPAC name of trimethyl 1-cyclohexyl-2-methyl-6-oxopyridine-3,4,5-tricarboxylate (CID 135005013) is trimethyl 1-cyclohexyl-2-methyl-6-oxopyridine-3,4,5-tricarboxylate.
What is the SMILES notation for trimethyl 1-cyclohexyl-2-methyl-6-oxopyridine-3,4,5-tricarboxylate?
The canonical SMILES for trimethyl 1-cyclohexyl-2-methyl-6-oxopyridine-3,4,5-tricarboxylate is COC(=O)c1c(C(=O)OC)c(C)n(C2CCCCC2)c(=O)c1C(=O)OC.
What is the InChIKey of trimethyl 1-cyclohexyl-2-methyl-6-oxopyridine-3,4,5-tricarboxylate?
The InChIKey is IXYMPSLDPQWWOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23NO7/c1-10-12(16(21)24-2)13(17(22)25-3)14(18(23)26-4)15(20)19(10)11-8-6-5-7-9-11/h11H,5-9H2,1-4H3.
What are the key properties of trimethyl 1-cyclohexyl-2-methyl-6-oxopyridine-3,4,5-tricarboxylate?
trimethyl 1-cyclohexyl-2-methyl-6-oxopyridine-3,4,5-tricarboxylate has a molecular weight of 365.38 g/mol, XLogP of 2.02, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl 1-cyclohexyl-2-methyl-6-oxopyridine-3,4,5-tricarboxylate is sourced from PubChem (CID 135005013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).