C13H15F3O3S3 — CID 135005104
[1-(1,3-dithian-2-yl)-2,2,2-trifluoroethyl] 4-methylbenzenesulfonate (PubChem CID 135005104) has the molecular formula C13H15F3O3S3 and a molecular weight of 372.46 g/mol. Its IUPAC name is [1-(1,3-dithian-2-yl)-2,2,2-trifluoroethyl] 4-methylbenzenesulfonate.
| Compound Name | [1-(1,3-dithian-2-yl)-2,2,2-trifluoroethyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 135005104 |
| Molecular Formula | C13H15F3O3S3 |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.01 |
| IUPAC Name | [1-(1,3-dithian-2-yl)-2,2,2-trifluoroethyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC(C2SCCCS2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H15F3O3S3/c1-9-3-5-10(6-4-9)22(17,18)19-11(13(14,15)16)12-20-7-2-8-21-12/h3-6,11-12H,2,7-8H2,1H3 |
| InChIKey | FALJSRARKHDHRG-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|