C13H15F3O4S3 — CID 135005105
[2,2,2-trifluoro-1-(1-oxo-1,3-dithian-2-yl)ethyl] 4-methylbenzenesulfonate (PubChem CID 135005105) has the molecular formula C13H15F3O4S3 and a molecular weight of 388.45 g/mol. Its IUPAC name is [2,2,2-trifluoro-1-(1-oxo-1,3-dithian-2-yl)ethyl] 4-methylbenzenesulfonate.
| Compound Name | [2,2,2-trifluoro-1-(1-oxo-1,3-dithian-2-yl)ethyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 135005105 |
| Molecular Formula | C13H15F3O4S3 |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.01 |
| IUPAC Name | [2,2,2-trifluoro-1-(1-oxo-1,3-dithian-2-yl)ethyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC(C2SCCCS2=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H15F3O4S3/c1-9-3-5-10(6-4-9)23(18,19)20-11(13(14,15)16)12-21-7-2-8-22(12)17/h3-6,11-12H,2,7-8H2,1H3 |
| InChIKey | HOHLKBWALVGONW-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|