About (3-dibromoindiganyl-3,3-difluoroprop-1-ynyl)-tri(propan-2-yl)silane
(3-dibromoindiganyl-3,3-difluoroprop-1-ynyl)-tri(propan-2-yl)silane (PubChem CID 135005110) has the molecular formula C12H21Br2F2InSi
and a molecular weight of 506.01 g/mol. Its IUPAC name is (3-dibromoindiganyl-3,3-difluoroprop-1-ynyl)-tri(propan-2-yl)silane.
Molecular Properties
| Compound Name | (3-dibromoindiganyl-3,3-difluoroprop-1-ynyl)-tri(propan-2-yl)silane |
| PubChem CID | 135005110 |
| Molecular Formula | C12H21Br2F2InSi |
| Molecular Weight | 506.01 g/mol |
| Exact Mass | 503.88 |
| IUPAC Name | (3-dibromoindiganyl-3,3-difluoroprop-1-ynyl)-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](C#CC(F)(F)[In](Br)Br)(C(C)C)C(C)C |
| InChI | InChI=1S/C12H21F2Si.2BrH.In/c1-9(2)15(10(3)4,11(5)6)8-7-12(13)14;;;/h9-11H,1-6H3;2*1H;/q;;;+2/p-2 |
| InChIKey | DOJSPMRKMUQOOU-UHFFFAOYSA-L |
| XLogP | 5.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 506.01 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (3-dibromoindiganyl-3,3-difluoroprop-1-ynyl)-tri(propan-2-yl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-dibromoindiganyl-3,3-difluoroprop-1-ynyl)-tri(propan-2-yl)silane?
The IUPAC name of (3-dibromoindiganyl-3,3-difluoroprop-1-ynyl)-tri(propan-2-yl)silane (CID 135005110) is (3-dibromoindiganyl-3,3-difluoroprop-1-ynyl)-tri(propan-2-yl)silane.
What is the SMILES notation for (3-dibromoindiganyl-3,3-difluoroprop-1-ynyl)-tri(propan-2-yl)silane?
The canonical SMILES for (3-dibromoindiganyl-3,3-difluoroprop-1-ynyl)-tri(propan-2-yl)silane is CC(C)[Si](C#CC(F)(F)[In](Br)Br)(C(C)C)C(C)C.
What is the InChIKey of (3-dibromoindiganyl-3,3-difluoroprop-1-ynyl)-tri(propan-2-yl)silane?
The InChIKey is DOJSPMRKMUQOOU-UHFFFAOYSA-L. The full InChI is InChI=1S/C12H21F2Si.2BrH.In/c1-9(2)15(10(3)4,11(5)6)8-7-12(13)14;;;/h9-11H,1-6H3;2*1H;/q;;;+2/p-2.
What are the key properties of (3-dibromoindiganyl-3,3-difluoroprop-1-ynyl)-tri(propan-2-yl)silane?
(3-dibromoindiganyl-3,3-difluoroprop-1-ynyl)-tri(propan-2-yl)silane has a molecular weight of 506.01 g/mol, XLogP of 5.66, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (3-dibromoindiganyl-3,3-difluoroprop-1-ynyl)-tri(propan-2-yl)silane is sourced from PubChem (CID 135005110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).