About carbon monoxide;[ethoxy-[1-[(4-fluorophenyl)methyl]-5-phenyltriazol-4-yl]methylidene]tungsten
carbon monoxide;[ethoxy-[1-[(4-fluorophenyl)methyl]-5-phenyltriazol-4-yl]methylidene]tungsten (PubChem CID 135005321) has the molecular formula C23H16FN3O6W
and a molecular weight of 633.23 g/mol. Its IUPAC name is carbon monoxide;[ethoxy-[1-[(4-fluorophenyl)methyl]-5-phenyltriazol-4-yl]methylidene]tungsten.
Molecular Properties
| Compound Name | carbon monoxide;[ethoxy-[1-[(4-fluorophenyl)methyl]-5-phenyltriazol-4-yl]methylidene]tungsten |
| PubChem CID | 135005321 |
| Molecular Formula | C23H16FN3O6W |
| Molecular Weight | 633.23 g/mol |
| Exact Mass | 633.05 |
| IUPAC Name | carbon monoxide;[ethoxy-[1-[(4-fluorophenyl)methyl]-5-phenyltriazol-4-yl]methylidene]tungsten |
| SMILES | CCOC(=[W])c1nnn(Cc2ccc(F)cc2)c1-c1ccccc1.[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+] |
| InChI | InChI=1S/C18H16FN3O.5CO.W/c1-2-23-13-17-18(15-6-4-3-5-7-15)22(21-20-17)12-14-8-10-16(19)11-9-14;5*1-2;/h3-11H,2,12H2,1H3;;;;;; |
| InChIKey | MRCGDVTTZFSNRM-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 139.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 633.23 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze carbon monoxide;[ethoxy-[1-[(4-fluorophenyl)methyl]-5-phenyltriazol-4-yl]methylidene]tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon monoxide;[ethoxy-[1-[(4-fluorophenyl)methyl]-5-phenyltriazol-4-yl]methylidene]tungsten?
The IUPAC name of carbon monoxide;[ethoxy-[1-[(4-fluorophenyl)methyl]-5-phenyltriazol-4-yl]methylidene]tungsten (CID 135005321) is carbon monoxide;[ethoxy-[1-[(4-fluorophenyl)methyl]-5-phenyltriazol-4-yl]methylidene]tungsten.
What is the SMILES notation for carbon monoxide;[ethoxy-[1-[(4-fluorophenyl)methyl]-5-phenyltriazol-4-yl]methylidene]tungsten?
The canonical SMILES for carbon monoxide;[ethoxy-[1-[(4-fluorophenyl)methyl]-5-phenyltriazol-4-yl]methylidene]tungsten is CCOC(=[W])c1nnn(Cc2ccc(F)cc2)c1-c1ccccc1.[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].
What is the InChIKey of carbon monoxide;[ethoxy-[1-[(4-fluorophenyl)methyl]-5-phenyltriazol-4-yl]methylidene]tungsten?
The InChIKey is MRCGDVTTZFSNRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16FN3O.5CO.W/c1-2-23-13-17-18(15-6-4-3-5-7-15)22(21-20-17)12-14-8-10-16(19)11-9-14;5*1-2;/h3-11H,2,12H2,1H3;;;;;;.
What are the key properties of carbon monoxide;[ethoxy-[1-[(4-fluorophenyl)methyl]-5-phenyltriazol-4-yl]methylidene]tungsten?
carbon monoxide;[ethoxy-[1-[(4-fluorophenyl)methyl]-5-phenyltriazol-4-yl]methylidene]tungsten has a molecular weight of 633.23 g/mol, XLogP of 3.01, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for carbon monoxide;[ethoxy-[1-[(4-fluorophenyl)methyl]-5-phenyltriazol-4-yl]methylidene]tungsten is sourced from PubChem (CID 135005321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).