C22H23NO2S — CID 135005496
(1S,5R)-4-methyl-6-(4-methylphenyl)sulfonyl-8-phenyl-6-azabicyclo[3.2.2]nona-2,8-diene (PubChem CID 135005496) has the molecular formula C22H23NO2S and a molecular weight of 365.50 g/mol. Its IUPAC name is (1S,5R)-4-methyl-6-(4-methylphenyl)sulfonyl-8-phenyl-6-azabicyclo[3.2.2]nona-2,8-diene.
| Compound Name | (1S,5R)-4-methyl-6-(4-methylphenyl)sulfonyl-8-phenyl-6-azabicyclo[3.2.2]nona-2,8-diene |
|---|---|
| PubChem CID | 135005496 |
| Molecular Formula | C22H23NO2S |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | (1S,5R)-4-methyl-6-(4-methylphenyl)sulfonyl-8-phenyl-6-azabicyclo[3.2.2]nona-2,8-diene |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@H]3C=CC(C)[C@@H]2C=C3c2ccccc2)cc1 |
| InChI | InChI=1S/C22H23NO2S/c1-16-8-12-20(13-9-16)26(24,25)23-15-19-11-10-17(2)22(23)14-21(19)18-6-4-3-5-7-18/h3-14,17,19,22H,15H2,1-2H3/t17?,19-,22+/m1/s1 |
| InChIKey | LWCPJKSXBGVYRW-BIVZGKPNSA-N |
| XLogP | 4.27 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|