C21H40O2Si — CID 135005522
1-[(3aS,4R,7aR)-1-[1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]ethanone (PubChem CID 135005522) has the molecular formula C21H40O2Si and a molecular weight of 352.64 g/mol. Its IUPAC name is 1-[(3aS,4R,7aR)-1-[1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]ethanone.
| Compound Name | 1-[(3aS,4R,7aR)-1-[1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]ethanone |
|---|---|
| PubChem CID | 135005522 |
| Molecular Formula | C21H40O2Si |
| Molecular Weight | 352.64 g/mol |
| Exact Mass | 352.28 |
| IUPAC Name | 1-[(3aS,4R,7aR)-1-[1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]ethanone |
| SMILES | CC(=O)[C@@H]1CCC[C@]2(C)C(C(C)CO[Si](C)(C)C(C)(C)C)CC[C@@H]12 |
| InChI | InChI=1S/C21H40O2Si/c1-15(14-23-24(7,8)20(3,4)5)18-11-12-19-17(16(2)22)10-9-13-21(18,19)6/h15,17-19H,9-14H2,1-8H3/t15?,17-,18?,19-,21+/m0/s1 |
| InChIKey | AAJJZEJGYXQKLO-STWHCMAKSA-N |
| XLogP | 6.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.64 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|