C20H28O — CID 135005717
(1R,5S,6R)-1-methyl-5-pentyl-6-(2-phenylethyl)bicyclo[3.1.0]hexan-3-one (PubChem CID 135005717) has the molecular formula C20H28O and a molecular weight of 284.44 g/mol. Its IUPAC name is (1R,5S,6R)-1-methyl-5-pentyl-6-(2-phenylethyl)bicyclo[3.1.0]hexan-3-one.
| Compound Name | (1R,5S,6R)-1-methyl-5-pentyl-6-(2-phenylethyl)bicyclo[3.1.0]hexan-3-one |
|---|---|
| PubChem CID | 135005717 |
| Molecular Formula | C20H28O |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | (1R,5S,6R)-1-methyl-5-pentyl-6-(2-phenylethyl)bicyclo[3.1.0]hexan-3-one |
| SMILES | CCCCC[C@@]12CC(=O)C[C@]1(C)[C@H]2CCc1ccccc1 |
| InChI | InChI=1S/C20H28O/c1-3-4-8-13-20-15-17(21)14-19(20,2)18(20)12-11-16-9-6-5-7-10-16/h5-7,9-10,18H,3-4,8,11-15H2,1-2H3/t18-,19-,20+/m1/s1 |
| InChIKey | AMUUCPGHSGAGSB-AQNXPRMDSA-N |
| XLogP | 5.18 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|