C11H7F5N2O2 — CID 135005924
methyl 5-(2,3,4,5,6-pentafluorophenyl)-4,5-dihydro-1H-pyrazole-3-carboxylate (PubChem CID 135005924) has the molecular formula C11H7F5N2O2 and a molecular weight of 294.18 g/mol. Its IUPAC name is methyl 5-(2,3,4,5,6-pentafluorophenyl)-4,5-dihydro-1H-pyrazole-3-carboxylate.
| Compound Name | methyl 5-(2,3,4,5,6-pentafluorophenyl)-4,5-dihydro-1H-pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 135005924 |
| Molecular Formula | C11H7F5N2O2 |
| Molecular Weight | 294.18 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | methyl 5-(2,3,4,5,6-pentafluorophenyl)-4,5-dihydro-1H-pyrazole-3-carboxylate |
| SMILES | COC(=O)C1=NNC(c2c(F)c(F)c(F)c(F)c2F)C1 |
| InChI | InChI=1S/C11H7F5N2O2/c1-20-11(19)4-2-3(17-18-4)5-6(12)8(14)10(16)9(15)7(5)13/h3,17H,2H2,1H3 |
| InChIKey | UKHLNFPLJUYWON-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.18 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|