C24H27NO2S — CID 135006134
(3aZ,5Z,9aR)-9a-methyl-2-(4-methylphenyl)sulfonyl-4-phenyl-3,7,8,9-tetrahydro-1H-cycloocta[c]pyrrole (PubChem CID 135006134) has the molecular formula C24H27NO2S and a molecular weight of 393.55 g/mol. Its IUPAC name is (3aZ,5Z,9aR)-9a-methyl-2-(4-methylphenyl)sulfonyl-4-phenyl-3,7,8,9-tetrahydro-1H-cycloocta[c]pyrrole.
| Compound Name | (3aZ,5Z,9aR)-9a-methyl-2-(4-methylphenyl)sulfonyl-4-phenyl-3,7,8,9-tetrahydro-1H-cycloocta[c]pyrrole |
|---|---|
| PubChem CID | 135006134 |
| Molecular Formula | C24H27NO2S |
| Molecular Weight | 393.55 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | (3aZ,5Z,9aR)-9a-methyl-2-(4-methylphenyl)sulfonyl-4-phenyl-3,7,8,9-tetrahydro-1H-cycloocta[c]pyrrole |
| SMILES | Cc1ccc(S(=O)(=O)N2C/C3=C(c4ccccc4)/C=C\CCC[C@@]3(C)C2)cc1 |
| InChI | InChI=1S/C24H27NO2S/c1-19-12-14-21(15-13-19)28(26,27)25-17-23-22(20-9-5-3-6-10-20)11-7-4-8-16-24(23,2)18-25/h3,5-7,9-15H,4,8,16-18H2,1-2H3/b11-7-,23-22+/t24-/m0/s1 |
| InChIKey | SGAHBNRDDBDVKB-BCYOKLFCSA-N |
| XLogP | 5.20 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.55 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |