C13H19NO4 — CID 135006161
methyl (1S,2S,3R,6R)-1-cyano-3-formyl-6-hydroxy-2-propylcyclohexane-1-carboxylate (PubChem CID 135006161) has the molecular formula C13H19NO4 and a molecular weight of 253.30 g/mol. Its IUPAC name is methyl (1S,2S,3R,6R)-1-cyano-3-formyl-6-hydroxy-2-propylcyclohexane-1-carboxylate.
| Compound Name | methyl (1S,2S,3R,6R)-1-cyano-3-formyl-6-hydroxy-2-propylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 135006161 |
| Molecular Formula | C13H19NO4 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | methyl (1S,2S,3R,6R)-1-cyano-3-formyl-6-hydroxy-2-propylcyclohexane-1-carboxylate |
| SMILES | CCC[C@H]1[C@H](C=O)CC[C@@H](O)[C@]1(C#N)C(=O)OC |
| InChI | InChI=1S/C13H19NO4/c1-3-4-10-9(7-15)5-6-11(16)13(10,8-14)12(17)18-2/h7,9-11,16H,3-6H2,1-2H3/t9-,10-,11+,13+/m0/s1 |
| InChIKey | ITLORQAYHYGSPX-MEWQQHAOSA-N |
| XLogP | 1.06 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|