C17H32GeO2Si — CID 135006289
4-[tert-butyl(dimethyl)silyl]oxy-3-trimethylgermyl-4,5,6,6a-tetrahydro-1H-pentalen-2-one (PubChem CID 135006289) has the molecular formula C17H32GeO2Si and a molecular weight of 369.14 g/mol. Its IUPAC name is 4-[tert-butyl(dimethyl)silyl]oxy-3-trimethylgermyl-4,5,6,6a-tetrahydro-1H-pentalen-2-one.
| Compound Name | 4-[tert-butyl(dimethyl)silyl]oxy-3-trimethylgermyl-4,5,6,6a-tetrahydro-1H-pentalen-2-one |
|---|---|
| PubChem CID | 135006289 |
| Molecular Formula | C17H32GeO2Si |
| Molecular Weight | 369.14 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 4-[tert-butyl(dimethyl)silyl]oxy-3-trimethylgermyl-4,5,6,6a-tetrahydro-1H-pentalen-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OC1CCC2CC(=O)C([Ge](C)(C)C)=C21 |
| InChI | InChI=1S/C17H32GeO2Si/c1-17(2,3)21(7,8)20-14-10-9-12-11-13(19)16(15(12)14)18(4,5)6/h12,14H,9-11H2,1-8H3 |
| InChIKey | MVKIBFIOHVRPFV-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.14 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|