C11H5F13N2O — CID 135006296
6-methyl-4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-1H-pyrimidin-2-one (PubChem CID 135006296) has the molecular formula C11H5F13N2O and a molecular weight of 428.15 g/mol. Its IUPAC name is 6-methyl-4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-1H-pyrimidin-2-one.
| Compound Name | 6-methyl-4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-1H-pyrimidin-2-one |
|---|---|
| PubChem CID | 135006296 |
| Molecular Formula | C11H5F13N2O |
| Molecular Weight | 428.15 g/mol |
| Exact Mass | 428.02 |
| IUPAC Name | 6-methyl-4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-1H-pyrimidin-2-one |
| SMILES | Cc1cc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)nc(=O)[nH]1 |
| InChI | InChI=1S/C11H5F13N2O/c1-3-2-4(26-5(27)25-3)6(12,13)7(14,15)8(16,17)9(18,19)10(20,21)11(22,23)24/h2H,1H3,(H,25,26,27) |
| InChIKey | GDIYECMQCJHZAL-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.15 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|