C8H14O3S2 — CID 135006462
(3S,4R)-4-(1,3-dithian-2-yl)-3,4-dihydroxybutan-2-one (PubChem CID 135006462) has the molecular formula C8H14O3S2 and a molecular weight of 222.33 g/mol. Its IUPAC name is (3S,4R)-4-(1,3-dithian-2-yl)-3,4-dihydroxybutan-2-one.
| Compound Name | (3S,4R)-4-(1,3-dithian-2-yl)-3,4-dihydroxybutan-2-one |
|---|---|
| PubChem CID | 135006462 |
| Molecular Formula | C8H14O3S2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.04 |
| IUPAC Name | (3S,4R)-4-(1,3-dithian-2-yl)-3,4-dihydroxybutan-2-one |
| SMILES | CC(=O)[C@@H](O)[C@@H](O)C1SCCCS1 |
| InChI | InChI=1S/C8H14O3S2/c1-5(9)6(10)7(11)8-12-3-2-4-13-8/h6-8,10-11H,2-4H2,1H3/t6-,7-/m1/s1 |
| InChIKey | LQQOPQKBSAWUAN-RNFRBKRXSA-N |
| XLogP | 0.49 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |