C31H50O5 — CID 135006554
bis(prop-2-enyl) 2-[(4E,6S,13Z)-3-oxodocosa-4,13-dien-6-yl]propanedioate (PubChem CID 135006554) has the molecular formula C31H50O5 and a molecular weight of 502.74 g/mol. Its IUPAC name is bis(prop-2-enyl) 2-[(4E,6S,13Z)-3-oxodocosa-4,13-dien-6-yl]propanedioate.
| Compound Name | bis(prop-2-enyl) 2-[(4E,6S,13Z)-3-oxodocosa-4,13-dien-6-yl]propanedioate |
|---|---|
| PubChem CID | 135006554 |
| Molecular Formula | C31H50O5 |
| Molecular Weight | 502.74 g/mol |
| Exact Mass | 502.37 |
| IUPAC Name | bis(prop-2-enyl) 2-[(4E,6S,13Z)-3-oxodocosa-4,13-dien-6-yl]propanedioate |
| SMILES | C=CCOC(=O)C(C(=O)OCC=C)[C@H](/C=C/C(=O)CC)CCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C31H50O5/c1-5-9-10-11-12-13-14-15-16-17-18-19-20-21-22-27(23-24-28(32)8-4)29(30(33)35-25-6-2)31(34)36-26-7-3/h6-7,15-16,23-24,27,29H,2-3,5,8-14,17-22,25-26H2,1,4H3/b16-15-,24-23+/t27-/m0/s1 |
| InChIKey | PEIFJRONVLGVEJ-WYAKDZFQSA-N |
| XLogP | 7.86 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.74 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|