C9H12N2O2S2 — CID 135006610
ethyl 6-methyl-4-methylsulfanyl-2-sulfanylidene-1H-pyrimidine-5-carboxylate (PubChem CID 135006610) has the molecular formula C9H12N2O2S2 and a molecular weight of 244.34 g/mol. Its IUPAC name is ethyl 6-methyl-4-methylsulfanyl-2-sulfanylidene-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl 6-methyl-4-methylsulfanyl-2-sulfanylidene-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 135006610 |
| Molecular Formula | C9H12N2O2S2 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.03 |
| IUPAC Name | ethyl 6-methyl-4-methylsulfanyl-2-sulfanylidene-1H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1c(SC)nc(=S)[nH]c1C |
| InChI | InChI=1S/C9H12N2O2S2/c1-4-13-8(12)6-5(2)10-9(14)11-7(6)15-3/h4H2,1-3H3,(H,10,11,14) |
| InChIKey | HCLMYLRTHFIDDV-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|