About [(2S)-1-(1,3-dioxoisoindol-2-yl)-3-(5-fluoro-2-phenylmethoxyphenyl)propan-2-yl] methanesulfonate
[(2S)-1-(1,3-dioxoisoindol-2-yl)-3-(5-fluoro-2-phenylmethoxyphenyl)propan-2-yl] methanesulfonate (PubChem CID 135006616) has the molecular formula C25H22FNO6S
and a molecular weight of 483.52 g/mol. Its IUPAC name is [(2S)-1-(1,3-dioxoisoindol-2-yl)-3-(5-fluoro-2-phenylmethoxyphenyl)propan-2-yl] methanesulfonate.
Molecular Properties
| Compound Name | [(2S)-1-(1,3-dioxoisoindol-2-yl)-3-(5-fluoro-2-phenylmethoxyphenyl)propan-2-yl] methanesulfonate |
| PubChem CID | 135006616 |
| Molecular Formula | C25H22FNO6S |
| Molecular Weight | 483.52 g/mol |
| Exact Mass | 483.12 |
| IUPAC Name | [(2S)-1-(1,3-dioxoisoindol-2-yl)-3-(5-fluoro-2-phenylmethoxyphenyl)propan-2-yl] methanesulfonate |
| SMILES | CS(=O)(=O)O[C@@H](Cc1cc(F)ccc1OCc1ccccc1)CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C25H22FNO6S/c1-34(30,31)33-20(15-27-24(28)21-9-5-6-10-22(21)25(27)29)14-18-13-19(26)11-12-23(18)32-16-17-7-3-2-4-8-17/h2-13,20H,14-16H2,1H3/t20-/m0/s1 |
| InChIKey | KWOWLKXWGXGILJ-FQEVSTJZSA-N |
| XLogP | 3.59 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 483.52 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [(2S)-1-(1,3-dioxoisoindol-2-yl)-3-(5-fluoro-2-phenylmethoxyphenyl)propan-2-yl] methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-1-(1,3-dioxoisoindol-2-yl)-3-(5-fluoro-2-phenylmethoxyphenyl)propan-2-yl] methanesulfonate?
The IUPAC name of [(2S)-1-(1,3-dioxoisoindol-2-yl)-3-(5-fluoro-2-phenylmethoxyphenyl)propan-2-yl] methanesulfonate (CID 135006616) is [(2S)-1-(1,3-dioxoisoindol-2-yl)-3-(5-fluoro-2-phenylmethoxyphenyl)propan-2-yl] methanesulfonate.
What is the SMILES notation for [(2S)-1-(1,3-dioxoisoindol-2-yl)-3-(5-fluoro-2-phenylmethoxyphenyl)propan-2-yl] methanesulfonate?
The canonical SMILES for [(2S)-1-(1,3-dioxoisoindol-2-yl)-3-(5-fluoro-2-phenylmethoxyphenyl)propan-2-yl] methanesulfonate is CS(=O)(=O)O[C@@H](Cc1cc(F)ccc1OCc1ccccc1)CN1C(=O)c2ccccc2C1=O.
What is the InChIKey of [(2S)-1-(1,3-dioxoisoindol-2-yl)-3-(5-fluoro-2-phenylmethoxyphenyl)propan-2-yl] methanesulfonate?
The InChIKey is KWOWLKXWGXGILJ-FQEVSTJZSA-N. The full InChI is InChI=1S/C25H22FNO6S/c1-34(30,31)33-20(15-27-24(28)21-9-5-6-10-22(21)25(27)29)14-18-13-19(26)11-12-23(18)32-16-17-7-3-2-4-8-17/h2-13,20H,14-16H2,1H3/t20-/m0/s1.
What are the key properties of [(2S)-1-(1,3-dioxoisoindol-2-yl)-3-(5-fluoro-2-phenylmethoxyphenyl)propan-2-yl] methanesulfonate?
[(2S)-1-(1,3-dioxoisoindol-2-yl)-3-(5-fluoro-2-phenylmethoxyphenyl)propan-2-yl] methanesulfonate has a molecular weight of 483.52 g/mol, XLogP of 3.59, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-1-(1,3-dioxoisoindol-2-yl)-3-(5-fluoro-2-phenylmethoxyphenyl)propan-2-yl] methanesulfonate is sourced from PubChem (CID 135006616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).