C14H23IO2Si — CID 135006683
4-[tert-butyl(dimethyl)silyl]oxy-3-iodo-4,5,6,6a-tetrahydro-1H-pentalen-2-one (PubChem CID 135006683) has the molecular formula C14H23IO2Si and a molecular weight of 378.33 g/mol. Its IUPAC name is 4-[tert-butyl(dimethyl)silyl]oxy-3-iodo-4,5,6,6a-tetrahydro-1H-pentalen-2-one.
| Compound Name | 4-[tert-butyl(dimethyl)silyl]oxy-3-iodo-4,5,6,6a-tetrahydro-1H-pentalen-2-one |
|---|---|
| PubChem CID | 135006683 |
| Molecular Formula | C14H23IO2Si |
| Molecular Weight | 378.33 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | 4-[tert-butyl(dimethyl)silyl]oxy-3-iodo-4,5,6,6a-tetrahydro-1H-pentalen-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OC1CCC2CC(=O)C(I)=C21 |
| InChI | InChI=1S/C14H23IO2Si/c1-14(2,3)18(4,5)17-11-7-6-9-8-10(16)13(15)12(9)11/h9,11H,6-8H2,1-5H3 |
| InChIKey | GAAFFPGZHBZROG-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.33 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|