C16H27IO2Si — CID 135006844
4-[tert-butyl(dimethyl)silyl]oxy-3-iodo-5,5-dimethyl-1,4,6,6a-tetrahydropentalen-2-one (PubChem CID 135006844) has the molecular formula C16H27IO2Si and a molecular weight of 406.38 g/mol. Its IUPAC name is 4-[tert-butyl(dimethyl)silyl]oxy-3-iodo-5,5-dimethyl-1,4,6,6a-tetrahydropentalen-2-one.
| Compound Name | 4-[tert-butyl(dimethyl)silyl]oxy-3-iodo-5,5-dimethyl-1,4,6,6a-tetrahydropentalen-2-one |
|---|---|
| PubChem CID | 135006844 |
| Molecular Formula | C16H27IO2Si |
| Molecular Weight | 406.38 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | 4-[tert-butyl(dimethyl)silyl]oxy-3-iodo-5,5-dimethyl-1,4,6,6a-tetrahydropentalen-2-one |
| SMILES | CC1(C)CC2CC(=O)C(I)=C2C1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H27IO2Si/c1-15(2,3)20(6,7)19-14-12-10(9-16(14,4)5)8-11(18)13(12)17/h10,14H,8-9H2,1-7H3 |
| InChIKey | OVGXVASBHJRJPH-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.38 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|