C20H37IO2Si2 — CID 135006988
5-[tert-butyl(dimethyl)silyl]-4-[tert-butyl(dimethyl)silyl]oxy-3-iodo-4,5,6,6a-tetrahydro-1H-pentalen-2-one (PubChem CID 135006988) has the molecular formula C20H37IO2Si2 and a molecular weight of 492.59 g/mol. Its IUPAC name is 5-[tert-butyl(dimethyl)silyl]-4-[tert-butyl(dimethyl)silyl]oxy-3-iodo-4,5,6,6a-tetrahydro-1H-pentalen-2-one.
| Compound Name | 5-[tert-butyl(dimethyl)silyl]-4-[tert-butyl(dimethyl)silyl]oxy-3-iodo-4,5,6,6a-tetrahydro-1H-pentalen-2-one |
|---|---|
| PubChem CID | 135006988 |
| Molecular Formula | C20H37IO2Si2 |
| Molecular Weight | 492.59 g/mol |
| Exact Mass | 492.14 |
| IUPAC Name | 5-[tert-butyl(dimethyl)silyl]-4-[tert-butyl(dimethyl)silyl]oxy-3-iodo-4,5,6,6a-tetrahydro-1H-pentalen-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OC1C2=C(I)C(=O)CC2CC1[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H37IO2Si2/c1-19(2,3)24(7,8)15-12-13-11-14(22)17(21)16(13)18(15)23-25(9,10)20(4,5)6/h13,15,18H,11-12H2,1-10H3 |
| InChIKey | CIHZXCQAMBIOIF-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.59 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|