C18H15ClO2S — CID 135007025
methyl 2-(4-chlorophenyl)-2-phenylsulfanylpenta-3,4-dienoate (PubChem CID 135007025) has the molecular formula C18H15ClO2S and a molecular weight of 330.84 g/mol. Its IUPAC name is methyl 2-(4-chlorophenyl)-2-phenylsulfanylpenta-3,4-dienoate.
| Compound Name | methyl 2-(4-chlorophenyl)-2-phenylsulfanylpenta-3,4-dienoate |
|---|---|
| PubChem CID | 135007025 |
| Molecular Formula | C18H15ClO2S |
| Molecular Weight | 330.84 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | methyl 2-(4-chlorophenyl)-2-phenylsulfanylpenta-3,4-dienoate |
| SMILES | C=C=CC(Sc1ccccc1)(C(=O)OC)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H15ClO2S/c1-3-13-18(17(20)21-2,14-9-11-15(19)12-10-14)22-16-7-5-4-6-8-16/h4-13H,1H2,2H3 |
| InChIKey | PNLDDTNYQWMMSS-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.84 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |