C17H24O5 — CID 135007113
dimethyl (1R,2S,5S)-5-ethoxy-1-methyltricyclo[5.3.0.02,5]dec-6-ene-9,9-dicarboxylate (PubChem CID 135007113) has the molecular formula C17H24O5 and a molecular weight of 308.37 g/mol. Its IUPAC name is dimethyl (1R,2S,5S)-5-ethoxy-1-methyltricyclo[5.3.0.02,5]dec-6-ene-9,9-dicarboxylate.
| Compound Name | dimethyl (1R,2S,5S)-5-ethoxy-1-methyltricyclo[5.3.0.02,5]dec-6-ene-9,9-dicarboxylate |
|---|---|
| PubChem CID | 135007113 |
| Molecular Formula | C17H24O5 |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | dimethyl (1R,2S,5S)-5-ethoxy-1-methyltricyclo[5.3.0.02,5]dec-6-ene-9,9-dicarboxylate |
| SMILES | CCO[C@@]12C=C3CC(C(=O)OC)(C(=O)OC)C[C@]3(C)[C@@H]1CC2 |
| InChI | InChI=1S/C17H24O5/c1-5-22-17-7-6-12(17)15(2)10-16(13(18)20-3,14(19)21-4)8-11(15)9-17/h9,12H,5-8,10H2,1-4H3/t12-,15-,17-/m0/s1 |
| InChIKey | ILKDFYUAYAMZDW-NUTKFTJISA-N |
| XLogP | 2.24 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|