C18H26O4 — CID 135007259
dimethyl 3-[(1Z)-2,6-dimethylhepta-1,5-dienyl]cyclopent-3-ene-1,1-dicarboxylate (PubChem CID 135007259) has the molecular formula C18H26O4 and a molecular weight of 306.40 g/mol. Its IUPAC name is dimethyl 3-[(1Z)-2,6-dimethylhepta-1,5-dienyl]cyclopent-3-ene-1,1-dicarboxylate.
| Compound Name | dimethyl 3-[(1Z)-2,6-dimethylhepta-1,5-dienyl]cyclopent-3-ene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 135007259 |
| Molecular Formula | C18H26O4 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | dimethyl 3-[(1Z)-2,6-dimethylhepta-1,5-dienyl]cyclopent-3-ene-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC=C(/C=C(/C)CCC=C(C)C)C1 |
| InChI | InChI=1S/C18H26O4/c1-13(2)7-6-8-14(3)11-15-9-10-18(12-15,16(19)21-4)17(20)22-5/h7,9,11H,6,8,10,12H2,1-5H3/b14-11- |
| InChIKey | OLGQGUUHMUQHAK-KAMYIIQDSA-N |
| XLogP | 3.73 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|