About disodium;(3R)-3-(2-carboxylatoprop-2-enyl)-4-hydroxycyclohexa-1,5-diene-1-carboxylate
disodium;(3R)-3-(2-carboxylatoprop-2-enyl)-4-hydroxycyclohexa-1,5-diene-1-carboxylate (PubChem CID 135007368) has the molecular formula C11H10Na2O5
and a molecular weight of 268.18 g/mol. Its IUPAC name is disodium;(3R)-3-(2-carboxylatoprop-2-enyl)-4-hydroxycyclohexa-1,5-diene-1-carboxylate.
Molecular Properties
| Compound Name | disodium;(3R)-3-(2-carboxylatoprop-2-enyl)-4-hydroxycyclohexa-1,5-diene-1-carboxylate |
| PubChem CID | 135007368 |
| Molecular Formula | C11H10Na2O5 |
| Molecular Weight | 268.18 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | disodium;(3R)-3-(2-carboxylatoprop-2-enyl)-4-hydroxycyclohexa-1,5-diene-1-carboxylate |
| SMILES | C=C(C[C@@H]1C=C(C(=O)[O-])C=CC1O)C(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C11H12O5.2Na/c1-6(10(13)14)4-8-5-7(11(15)16)2-3-9(8)12;;/h2-3,5,8-9,12H,1,4H2,(H,13,14)(H,15,16);;/q;2*+1/p-2/t8-,9?;;/m1../s1 |
| InChIKey | CJVPRKYDRDAWSC-QMKDJUJBSA-L |
| XLogP | -8.09 |
| TPSA | 100.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.18 |
| LogP ≤ 5 | -8.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze disodium;(3R)-3-(2-carboxylatoprop-2-enyl)-4-hydroxycyclohexa-1,5-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;(3R)-3-(2-carboxylatoprop-2-enyl)-4-hydroxycyclohexa-1,5-diene-1-carboxylate?
The IUPAC name of disodium;(3R)-3-(2-carboxylatoprop-2-enyl)-4-hydroxycyclohexa-1,5-diene-1-carboxylate (CID 135007368) is disodium;(3R)-3-(2-carboxylatoprop-2-enyl)-4-hydroxycyclohexa-1,5-diene-1-carboxylate.
What is the SMILES notation for disodium;(3R)-3-(2-carboxylatoprop-2-enyl)-4-hydroxycyclohexa-1,5-diene-1-carboxylate?
The canonical SMILES for disodium;(3R)-3-(2-carboxylatoprop-2-enyl)-4-hydroxycyclohexa-1,5-diene-1-carboxylate is C=C(C[C@@H]1C=C(C(=O)[O-])C=CC1O)C(=O)[O-].[Na+].[Na+].
What is the InChIKey of disodium;(3R)-3-(2-carboxylatoprop-2-enyl)-4-hydroxycyclohexa-1,5-diene-1-carboxylate?
The InChIKey is CJVPRKYDRDAWSC-QMKDJUJBSA-L. The full InChI is InChI=1S/C11H12O5.2Na/c1-6(10(13)14)4-8-5-7(11(15)16)2-3-9(8)12;;/h2-3,5,8-9,12H,1,4H2,(H,13,14)(H,15,16);;/q;2*+1/p-2/t8-,9?;;/m1../s1.
What are the key properties of disodium;(3R)-3-(2-carboxylatoprop-2-enyl)-4-hydroxycyclohexa-1,5-diene-1-carboxylate?
disodium;(3R)-3-(2-carboxylatoprop-2-enyl)-4-hydroxycyclohexa-1,5-diene-1-carboxylate has a molecular weight of 268.18 g/mol, XLogP of -8.09, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;(3R)-3-(2-carboxylatoprop-2-enyl)-4-hydroxycyclohexa-1,5-diene-1-carboxylate is sourced from PubChem (CID 135007368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).