C12H14F5NSi — CID 135007371
(E)-2,2,3,3,3-pentafluoro-1-phenyl-N-trimethylsilylpropan-1-imine (PubChem CID 135007371) has the molecular formula C12H14F5NSi and a molecular weight of 295.33 g/mol. Its IUPAC name is (E)-2,2,3,3,3-pentafluoro-1-phenyl-N-trimethylsilylpropan-1-imine.
| Compound Name | (E)-2,2,3,3,3-pentafluoro-1-phenyl-N-trimethylsilylpropan-1-imine |
|---|---|
| PubChem CID | 135007371 |
| Molecular Formula | C12H14F5NSi |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | (E)-2,2,3,3,3-pentafluoro-1-phenyl-N-trimethylsilylpropan-1-imine |
| SMILES | C[Si](C)(C)/N=C(\c1ccccc1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H14F5NSi/c1-19(2,3)18-10(9-7-5-4-6-8-9)11(13,14)12(15,16)17/h4-8H,1-3H3/b18-10+ |
| InChIKey | VQGIRIQWPNPLGS-VCHYOVAHSA-N |
| XLogP | 4.51 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|