C25H40O3SSi — CID 135007478
ethyl (2E,4Z,6S,7R)-7-[tert-butyl(dimethyl)silyl]oxy-6,8-dimethyl-4-phenylsulfanylnona-2,4-dienoate (PubChem CID 135007478) has the molecular formula C25H40O3SSi and a molecular weight of 448.75 g/mol. Its IUPAC name is ethyl (2E,4Z,6S,7R)-7-[tert-butyl(dimethyl)silyl]oxy-6,8-dimethyl-4-phenylsulfanylnona-2,4-dienoate.
| Compound Name | ethyl (2E,4Z,6S,7R)-7-[tert-butyl(dimethyl)silyl]oxy-6,8-dimethyl-4-phenylsulfanylnona-2,4-dienoate |
|---|---|
| PubChem CID | 135007478 |
| Molecular Formula | C25H40O3SSi |
| Molecular Weight | 448.75 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | ethyl (2E,4Z,6S,7R)-7-[tert-butyl(dimethyl)silyl]oxy-6,8-dimethyl-4-phenylsulfanylnona-2,4-dienoate |
| SMILES | CCOC(=O)/C=C/C(=C/[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)C(C)C)Sc1ccccc1 |
| InChI | InChI=1S/C25H40O3SSi/c1-10-27-23(26)17-16-22(29-21-14-12-11-13-15-21)18-20(4)24(19(2)3)28-30(8,9)25(5,6)7/h11-20,24H,10H2,1-9H3/b17-16+,22-18-/t20-,24+/m0/s1 |
| InChIKey | SSLPKVTWVKFFHT-XMBDJTQQSA-N |
| XLogP | 7.46 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.75 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|