C22H24O4S2 — CID 135007499
[(3R,4R)-1-(benzenesulfonyl)-3-ethenyl-4-prop-1-en-2-ylcyclopentyl]sulfonylbenzene (PubChem CID 135007499) has the molecular formula C22H24O4S2 and a molecular weight of 416.56 g/mol. Its IUPAC name is [(3R,4R)-1-(benzenesulfonyl)-3-ethenyl-4-prop-1-en-2-ylcyclopentyl]sulfonylbenzene.
| Compound Name | [(3R,4R)-1-(benzenesulfonyl)-3-ethenyl-4-prop-1-en-2-ylcyclopentyl]sulfonylbenzene |
|---|---|
| PubChem CID | 135007499 |
| Molecular Formula | C22H24O4S2 |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | [(3R,4R)-1-(benzenesulfonyl)-3-ethenyl-4-prop-1-en-2-ylcyclopentyl]sulfonylbenzene |
| SMILES | C=C[C@H]1CC(S(=O)(=O)c2ccccc2)(S(=O)(=O)c2ccccc2)C[C@H]1C(=C)C |
| InChI | InChI=1S/C22H24O4S2/c1-4-18-15-22(16-21(18)17(2)3,27(23,24)19-11-7-5-8-12-19)28(25,26)20-13-9-6-10-14-20/h4-14,18,21H,1-2,15-16H2,3H3/t18-,21-/m0/s1 |
| InChIKey | AIIOMCKMNMTOPW-RXVVDRJESA-N |
| XLogP | 4.42 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|