C32H52O5Si — CID 135007542
[1-[tert-butyl(dimethyl)silyl]oxy-4-methylpent-4-en-2-yl] (2E,4Z,7S,8E)-7-hydroxy-5-methyl-10-[(2S,6S)-4-methylidene-6-prop-1-en-2-yloxan-2-yl]deca-2,4,8-trienoate (PubChem CID 135007542) has the molecular formula C32H52O5Si and a molecular weight of 544.85 g/mol. Its IUPAC name is [1-[tert-butyl(dimethyl)silyl]oxy-4-methylpent-4-en-2-yl] (2E,4Z,7S,8E)-7-hydroxy-5-methyl-10-[(2S,6S)-4-methylidene-6-prop-1-en-2-yloxan-2-yl]deca-2,4,8-trienoate.
| Compound Name | [1-[tert-butyl(dimethyl)silyl]oxy-4-methylpent-4-en-2-yl] (2E,4Z,7S,8E)-7-hydroxy-5-methyl-10-[(2S,6S)-4-methylidene-6-prop-1-en-2-yloxan-2-yl]deca-2,4,8-trienoate |
|---|---|
| PubChem CID | 135007542 |
| Molecular Formula | C32H52O5Si |
| Molecular Weight | 544.85 g/mol |
| Exact Mass | 544.36 |
| IUPAC Name | [1-[tert-butyl(dimethyl)silyl]oxy-4-methylpent-4-en-2-yl] (2E,4Z,7S,8E)-7-hydroxy-5-methyl-10-[(2S,6S)-4-methylidene-6-prop-1-en-2-yloxan-2-yl]deca-2,4,8-trienoate |
| SMILES | C=C(C)CC(CO[Si](C)(C)C(C)(C)C)OC(=O)/C=C/C=C(/C)C[C@H](O)/C=C/C[C@H]1CC(=C)C[C@@H](C(=C)C)O1 |
| InChI | InChI=1S/C32H52O5Si/c1-23(2)18-29(22-35-38(10,11)32(7,8)9)37-31(34)17-12-14-25(5)19-27(33)15-13-16-28-20-26(6)21-30(36-28)24(3)4/h12-15,17,27-30,33H,1,3,6,16,18-22H2,2,4-5,7-11H3/b15-13+,17-12+,25-14-/t27-,28+,29?,30+/m1/s1 |
| InChIKey | CECPYIYABZSJJG-VPHACCRNSA-N |
| XLogP | 7.77 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.85 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|