C17H29ClN2Si — CID 135007642
2-benzyl-1,3-ditert-butyl-2-chloro-1,3,2-diazasilolidine (PubChem CID 135007642) has the molecular formula C17H29ClN2Si and a molecular weight of 324.97 g/mol. Its IUPAC name is 2-benzyl-1,3-ditert-butyl-2-chloro-1,3,2-diazasilolidine.
| Compound Name | 2-benzyl-1,3-ditert-butyl-2-chloro-1,3,2-diazasilolidine |
|---|---|
| PubChem CID | 135007642 |
| Molecular Formula | C17H29ClN2Si |
| Molecular Weight | 324.97 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | 2-benzyl-1,3-ditert-butyl-2-chloro-1,3,2-diazasilolidine |
| SMILES | CC(C)(C)N1CCN(C(C)(C)C)[Si]1(Cl)Cc1ccccc1 |
| InChI | InChI=1S/C17H29ClN2Si/c1-16(2,3)19-12-13-20(17(4,5)6)21(19,18)14-15-10-8-7-9-11-15/h7-11H,12-14H2,1-6H3 |
| InChIKey | LNGXQKNCYYDKTA-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.97 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|