C33H49BrN4Si2 — CID 135007795
2-bromo-1,3-ditert-butyl-2-[1,3-ditert-butyl-2-(9H-fluoren-9-yl)-1,3,2-diazasilol-2-yl]-1,3,2-diazasilole (PubChem CID 135007795) has the molecular formula C33H49BrN4Si2 and a molecular weight of 637.86 g/mol. Its IUPAC name is 2-bromo-1,3-ditert-butyl-2-[1,3-ditert-butyl-2-(9H-fluoren-9-yl)-1,3,2-diazasilol-2-yl]-1,3,2-diazasilole.
| Compound Name | 2-bromo-1,3-ditert-butyl-2-[1,3-ditert-butyl-2-(9H-fluoren-9-yl)-1,3,2-diazasilol-2-yl]-1,3,2-diazasilole |
|---|---|
| PubChem CID | 135007795 |
| Molecular Formula | C33H49BrN4Si2 |
| Molecular Weight | 637.86 g/mol |
| Exact Mass | 636.27 |
| IUPAC Name | 2-bromo-1,3-ditert-butyl-2-[1,3-ditert-butyl-2-(9H-fluoren-9-yl)-1,3,2-diazasilol-2-yl]-1,3,2-diazasilole |
| SMILES | CC(C)(C)N1C=CN(C(C)(C)C)[Si]1(Br)[Si]1(C2c3ccccc3-c3ccccc32)N(C(C)(C)C)C=CN1C(C)(C)C |
| InChI | InChI=1S/C33H49BrN4Si2/c1-30(2,3)35-21-22-36(31(4,5)6)39(35,40(34)37(32(7,8)9)23-24-38(40)33(10,11)12)29-27-19-15-13-17-25(27)26-18-14-16-20-28(26)29/h13-24,29H,1-12H3 |
| InChIKey | SXWLYDBRBHDOEX-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.86 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|